C17H9ClFN3O2S2 — CID 7543466
5-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]thiophene-2-carboxamide (PubChem CID 7543466) has the molecular formula C17H9ClFN3O2S2 and a molecular weight of 405.86 g/mol. Its IUPAC name is 5-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7543466 |
| Molecular Formula | C17H9ClFN3O2S2 |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 5-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(c1ccc(Cl)s1)N(/N=C\c1ccco1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C17H9ClFN3O2S2/c18-15-6-5-13(25-15)16(23)22(20-9-11-2-1-7-24-11)17-21-12-4-3-10(19)8-14(12)26-17/h1-9H/b20-9- |
| InChIKey | RSOMCKQSSQQMCC-UKWGHVSLSA-N |
| XLogP | 5.42 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|