C22H19N3O2S — CID 8609208
N-[(Z)-furan-2-ylmethylideneamino]-2,4-dimethyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 8609208) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[(Z)-furan-2-ylmethylideneamino]-2,4-dimethyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-[(Z)-furan-2-ylmethylideneamino]-2,4-dimethyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8609208 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[(Z)-furan-2-ylmethylideneamino]-2,4-dimethyl-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | Cc1ccc(C(=O)N(/N=C\c2ccco2)c2nc3ccc(C)cc3s2)c(C)c1 |
| InChI | InChI=1S/C22H19N3O2S/c1-14-6-8-18(16(3)11-14)21(26)25(23-13-17-5-4-10-27-17)22-24-19-9-7-15(2)12-20(19)28-22/h4-13H,1-3H3/b23-13- |
| InChIKey | XFIJCKMMKXHOED-QRVIBDJDSA-N |
| XLogP | 5.50 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|