C24H21N3O2S — CID 44944323
N-[(E)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 44944323) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[(E)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[(E)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 44944323 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[(E)-furan-2-ylmethylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccco3)C(=O)c3ccc4c(c3)CCCC4)sc2c1 |
| InChI | InChI=1S/C24H21N3O2S/c1-16-8-11-21-22(13-16)30-24(26-21)27(25-15-20-7-4-12-29-20)23(28)19-10-9-17-5-2-3-6-18(17)14-19/h4,7-15H,2-3,5-6H2,1H3/b25-15+ |
| InChIKey | MXIGYTJKEZYDTP-MFKUBSTISA-N |
| XLogP | 5.76 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|