C20H14ClN3O3S — CID 7543643
4-chloro-N-[(Z)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 7543643) has the molecular formula C20H14ClN3O3S and a molecular weight of 411.87 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-chloro-N-[(Z)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7543643 |
| Molecular Formula | C20H14ClN3O3S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 4-chloro-N-[(Z)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1ccc2nc(N(/N=C\c3ccco3)C(=O)c3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C20H14ClN3O3S/c1-26-15-8-9-17-18(11-15)28-20(23-17)24(22-12-16-3-2-10-27-16)19(25)13-4-6-14(21)7-5-13/h2-12H,1H3/b22-12- |
| InChIKey | UGIKIOKXUVYUNL-UUYOSTAYSA-N |
| XLogP | 5.23 |
| TPSA | 67.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|