C27H28N4O5S2 — CID 44945556
4-(2-ethylpiperidin-1-yl)sulfonyl-N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 44945556) has the molecular formula C27H28N4O5S2 and a molecular weight of 552.68 g/mol. Its IUPAC name is 4-(2-ethylpiperidin-1-yl)sulfonyl-N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-(2-ethylpiperidin-1-yl)sulfonyl-N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 44945556 |
| Molecular Formula | C27H28N4O5S2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 4-(2-ethylpiperidin-1-yl)sulfonyl-N-[(E)-furan-2-ylmethylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccco2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C27H28N4O5S2/c1-3-20-7-4-5-15-30(20)38(33,34)23-12-9-19(10-13-23)26(32)31(28-18-22-8-6-16-36-22)27-29-24-14-11-21(35-2)17-25(24)37-27/h6,8-14,16-18,20H,3-5,7,15H2,1-2H3/b28-18+ |
| InChIKey | QYYXWOBIYDCIQL-MTDXEUNCSA-N |
| XLogP | 5.53 |
| TPSA | 105.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|