C26H26N4O4S3 — CID 44945595
4-(azepan-1-ylsulfonyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44945595) has the molecular formula C26H26N4O4S3 and a molecular weight of 554.72 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44945595 |
| Molecular Formula | C26H26N4O4S3 |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3cccs3)C(=O)c3ccc(S(=O)(=O)N4CCCCCC4)cc3)sc2c1 |
| InChI | InChI=1S/C26H26N4O4S3/c1-34-20-10-13-23-24(17-20)36-26(28-23)30(27-18-21-7-6-16-35-21)25(31)19-8-11-22(12-9-19)37(32,33)29-14-4-2-3-5-15-29/h6-13,16-18H,2-5,14-15H2,1H3/b27-18+ |
| InChIKey | MSDKDGJSNJQYMY-OVVQPSECSA-N |
| XLogP | 5.61 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|