C22H17N3O4S2 — CID 44945612
methyl 4-[(6-methoxy-1,3-benzothiazol-2-yl)-[(E)-thiophen-2-ylmethylideneamino]carbamoyl]benzoate (PubChem CID 44945612) has the molecular formula C22H17N3O4S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is methyl 4-[(6-methoxy-1,3-benzothiazol-2-yl)-[(E)-thiophen-2-ylmethylideneamino]carbamoyl]benzoate.
| Compound Name | methyl 4-[(6-methoxy-1,3-benzothiazol-2-yl)-[(E)-thiophen-2-ylmethylideneamino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 44945612 |
| Molecular Formula | C22H17N3O4S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | methyl 4-[(6-methoxy-1,3-benzothiazol-2-yl)-[(E)-thiophen-2-ylmethylideneamino]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N(/N=C/c2cccs2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C22H17N3O4S2/c1-28-16-9-10-18-19(12-16)31-22(24-18)25(23-13-17-4-3-11-30-17)20(26)14-5-7-15(8-6-14)21(27)29-2/h3-13H,1-2H3/b23-13+ |
| InChIKey | BXIOFBGCMGXVSP-YDZHTSKRSA-N |
| XLogP | 4.83 |
| TPSA | 81.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|