C18H15N3O4S2 — CID 7543685
N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 7543685) has the molecular formula C18H15N3O4S2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 7543685 |
| Molecular Formula | C18H15N3O4S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | COc1ccc2nc(N(/N=C\c3cccs3)C(=O)C3=COCCO3)sc2c1 |
| InChI | InChI=1S/C18H15N3O4S2/c1-23-12-4-5-14-16(9-12)27-18(20-14)21(19-10-13-3-2-8-26-13)17(22)15-11-24-6-7-25-15/h2-5,8-11H,6-7H2,1H3/b19-10- |
| InChIKey | JVVNWUMQFCANFR-GRSHGNNSSA-N |
| XLogP | 3.62 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|