C24H18N4O4S2 — CID 44945611
3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44945611) has the molecular formula C24H18N4O4S2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44945611 |
| Molecular Formula | C24H18N4O4S2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3cccs3)C(=O)c3cccc(N4C(=O)CCC4=O)c3)sc2c1 |
| InChI | InChI=1S/C24H18N4O4S2/c1-32-17-7-8-19-20(13-17)34-24(26-19)28(25-14-18-6-3-11-33-18)23(31)15-4-2-5-16(12-15)27-21(29)9-10-22(27)30/h2-8,11-14H,9-10H2,1H3/b25-14+ |
| InChIKey | PUCQWZALVNHXTQ-AFUMVMLFSA-N |
| XLogP | 4.70 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|