C24H17N5O6S2 — CID 44946071
4-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44946071) has the molecular formula C24H17N5O6S2 and a molecular weight of 535.56 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44946071 |
| Molecular Formula | C24H17N5O6S2 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])s3)C(=O)c3ccc(N4C(=O)CCC4=O)cc3)sc2c1 |
| InChI | InChI=1S/C24H17N5O6S2/c1-35-16-6-8-18-19(12-16)37-24(26-18)28(25-13-17-7-11-22(36-17)29(33)34)23(32)14-2-4-15(5-3-14)27-20(30)9-10-21(27)31/h2-8,11-13H,9-10H2,1H3/b25-13+ |
| InChIKey | CCXRTQVOJRDJKC-DHRITJCHSA-N |
| XLogP | 4.61 |
| TPSA | 135.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|