C26H19N5O6S — CID 44945798
3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44945798) has the molecular formula C26H19N5O6S and a molecular weight of 529.53 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945798 |
| Molecular Formula | C26H19N5O6S |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])cc3)C(=O)c3cccc(N4C(=O)CCC4=O)c3)sc2c1 |
| InChI | InChI=1S/C26H19N5O6S/c1-37-20-9-10-21-22(14-20)38-26(28-21)30(27-15-16-5-7-18(8-6-16)31(35)36)25(34)17-3-2-4-19(13-17)29-23(32)11-12-24(29)33/h2-10,13-15H,11-12H2,1H3/b27-15+ |
| InChIKey | APQHVJCSHMEEMJ-JFLMPSFJSA-N |
| XLogP | 4.55 |
| TPSA | 135.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|