C23H15N5O4S2 — CID 44945831
N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 44945831) has the molecular formula C23H15N5O4S2 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 44945831 |
| Molecular Formula | C23H15N5O4S2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])cc3)C(=O)c3ccc4ncsc4c3)sc2c1 |
| InChI | InChI=1S/C23H15N5O4S2/c1-32-17-7-9-19-21(11-17)34-23(26-19)27(25-12-14-2-5-16(6-3-14)28(30)31)22(29)15-4-8-18-20(10-15)33-13-24-18/h2-13H,1H3/b25-12+ |
| InChIKey | CPBQQEUIDYDYER-BRJLIKDPSA-N |
| XLogP | 5.50 |
| TPSA | 110.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|