C24H18N4O3S2 — CID 44946020
N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 44946020) has the molecular formula C24H18N4O3S2 and a molecular weight of 474.57 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 44946020 |
| Molecular Formula | C24H18N4O3S2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc3ncsc3c2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C24H18N4O3S2/c1-30-17-6-3-15(4-7-17)13-26-28(23(29)16-5-9-19-21(11-16)32-14-25-19)24-27-20-10-8-18(31-2)12-22(20)33-24/h3-14H,1-2H3/b26-13+ |
| InChIKey | XUAREOCZALZNIY-LGJNPRDNSA-N |
| XLogP | 5.60 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|