C23H15FN4O2S — CID 44945865
4-cyano-N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 44945865) has the molecular formula C23H15FN4O2S and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-cyano-N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-cyano-N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 44945865 |
| Molecular Formula | C23H15FN4O2S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 4-cyano-N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc(F)cc3)C(=O)c3ccc(C#N)cc3)sc2c1 |
| InChI | InChI=1S/C23H15FN4O2S/c1-30-19-10-11-20-21(12-19)31-23(27-20)28(26-14-16-4-8-18(24)9-5-16)22(29)17-6-2-15(13-25)3-7-17/h2-12,14H,1H3/b26-14+ |
| InChIKey | XJAXIDSCGGTKKY-VULFUBBASA-N |
| XLogP | 5.00 |
| TPSA | 78.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|