C24H18FN3O4S — CID 16822064
N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 16822064) has the molecular formula C24H18FN3O4S and a molecular weight of 463.49 g/mol. Its IUPAC name is N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 16822064 |
| Molecular Formula | C24H18FN3O4S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc(F)cc3)C(=O)c3ccc4c(c3)OCCO4)sc2c1 |
| InChI | InChI=1S/C24H18FN3O4S/c1-30-18-7-8-19-22(13-18)33-24(27-19)28(26-14-15-2-5-17(25)6-3-15)23(29)16-4-9-20-21(12-16)32-11-10-31-20/h2-9,12-14H,10-11H2,1H3/b26-14+ |
| InChIKey | ASHSBBUAOOPKLH-VULFUBBASA-N |
| XLogP | 4.90 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|