C23H18FN3O2S — CID 44943514
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methylbenzamide (PubChem CID 44943514) has the molecular formula C23H18FN3O2S and a molecular weight of 419.48 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methylbenzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 44943514 |
| Molecular Formula | C23H18FN3O2S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-4-methylbenzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc(C)cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C23H18FN3O2S/c1-15-3-7-17(8-4-15)22(28)27(25-14-16-5-10-19(29-2)11-6-16)23-26-20-12-9-18(24)13-21(20)30-23/h3-14H,1-2H3/b25-14+ |
| InChIKey | OUOCZOVSCXPWQC-AFUMVMLFSA-N |
| XLogP | 5.43 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|