C24H21FN4OS — CID 44943298
4-(dimethylamino)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]benzamide (PubChem CID 44943298) has the molecular formula C24H21FN4OS and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-(dimethylamino)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]benzamide.
| Compound Name | 4-(dimethylamino)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943298 |
| Molecular Formula | C24H21FN4OS |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-(dimethylamino)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]benzamide |
| SMILES | Cc1ccc(/C=N/N(C(=O)c2ccc(N(C)C)cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C24H21FN4OS/c1-16-4-6-17(7-5-16)15-26-29(23(30)18-8-11-20(12-9-18)28(2)3)24-27-21-13-10-19(25)14-22(21)31-24/h4-15H,1-3H3/b26-15+ |
| InChIKey | XBTUYDBMCUIFRZ-CVKSISIWSA-N |
| XLogP | 5.49 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|