C22H15ClFN3OS — CID 44944627
3-chloro-N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 44944627) has the molecular formula C22H15ClFN3OS and a molecular weight of 423.90 g/mol. Its IUPAC name is 3-chloro-N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-chloro-N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 44944627 |
| Molecular Formula | C22H15ClFN3OS |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-chloro-N-[(E)-(4-fluorophenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccc(F)cc3)C(=O)c3cccc(Cl)c3)sc2c1 |
| InChI | InChI=1S/C22H15ClFN3OS/c1-14-5-10-19-20(11-14)29-22(26-19)27(21(28)16-3-2-4-17(23)12-16)25-13-15-6-8-18(24)9-7-15/h2-13H,1H3/b25-13+ |
| InChIKey | HYLYEJSYOFMWRS-DHRITJCHSA-N |
| XLogP | 6.08 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|