C17H14FN3OS — CID 7543493
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-(4-methylphenyl)methylideneamino]acetamide (PubChem CID 7543493) has the molecular formula C17H14FN3OS and a molecular weight of 327.38 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-(4-methylphenyl)methylideneamino]acetamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-(4-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 7543493 |
| Molecular Formula | C17H14FN3OS |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-(4-methylphenyl)methylideneamino]acetamide |
| SMILES | CC(=O)N(/N=C\c1ccc(C)cc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C17H14FN3OS/c1-11-3-5-13(6-4-11)10-19-21(12(2)22)17-20-15-8-7-14(18)9-16(15)23-17/h3-10H,1-2H3/b19-10- |
| InChIKey | OHYMMDUOIOTQRE-GRSHGNNSSA-N |
| XLogP | 4.13 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|