C28H17F2N3O2S — CID 44943433
4-benzoyl-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]benzamide (PubChem CID 44943433) has the molecular formula C28H17F2N3O2S and a molecular weight of 497.53 g/mol. Its IUPAC name is 4-benzoyl-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]benzamide.
| Compound Name | 4-benzoyl-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943433 |
| Molecular Formula | C28H17F2N3O2S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 4-benzoyl-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]benzamide |
| SMILES | O=C(c1ccccc1)c1ccc(C(=O)N(/N=C/c2ccc(F)cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C28H17F2N3O2S/c29-22-12-6-18(7-13-22)17-31-33(28-32-24-15-14-23(30)16-25(24)36-28)27(35)21-10-8-20(9-11-21)26(34)19-4-2-1-3-5-19/h1-17H/b31-17+ |
| InChIKey | VGEARXGAQUMCMR-KBVAKVRCSA-N |
| XLogP | 6.49 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|