C23H18FN3OS — CID 44942772
N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-2,4-dimethylbenzamide (PubChem CID 44942772) has the molecular formula C23H18FN3OS and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-2,4-dimethylbenzamide.
| Compound Name | N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 44942772 |
| Molecular Formula | C23H18FN3OS |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(/N=C/c2ccccc2)c2nc3ccc(F)cc3s2)c(C)c1 |
| InChI | InChI=1S/C23H18FN3OS/c1-15-8-10-19(16(2)12-15)22(28)27(25-14-17-6-4-3-5-7-17)23-26-20-11-9-18(24)13-21(20)29-23/h3-14H,1-2H3/b25-14+ |
| InChIKey | CKCMDEWURQGJAF-AFUMVMLFSA-N |
| XLogP | 5.73 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|