C24H19ClFN3O4S — CID 44942976
3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 44942976) has the molecular formula C24H19ClFN3O4S and a molecular weight of 499.95 g/mol. Its IUPAC name is 3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942976 |
| Molecular Formula | C24H19ClFN3O4S |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/N(C(=O)c2cccc(Cl)c2)c2nc3ccc(F)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C24H19ClFN3O4S/c1-31-19-9-14(10-20(32-2)22(19)33-3)13-27-29(23(30)15-5-4-6-16(25)11-15)24-28-18-8-7-17(26)12-21(18)34-24/h4-13H,1-3H3/b27-13+ |
| InChIKey | LRFRXRDRWQGGDB-UVHMKAGCSA-N |
| XLogP | 5.80 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|