C27H27N3O7S — CID 44945485
2,3-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 44945485) has the molecular formula C27H27N3O7S and a molecular weight of 537.59 g/mol. Its IUPAC name is 2,3-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 2,3-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945485 |
| Molecular Formula | C27H27N3O7S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 2,3-dimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3cc(OC)c(OC)c(OC)c3)C(=O)c3cccc(OC)c3OC)sc2c1 |
| InChI | InChI=1S/C27H27N3O7S/c1-32-17-10-11-19-23(14-17)38-27(29-19)30(26(31)18-8-7-9-20(33-2)24(18)36-5)28-15-16-12-21(34-3)25(37-6)22(13-16)35-4/h7-15H,1-6H3/b28-15+ |
| InChIKey | NQQZTKNVPDWAJM-RWPZCVJISA-N |
| XLogP | 5.03 |
| TPSA | 100.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|