C28H29N3O8S — CID 44945409
3,4,5-trimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 44945409) has the molecular formula C28H29N3O8S and a molecular weight of 567.62 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945409 |
| Molecular Formula | C28H29N3O8S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3cc(OC)c(OC)c(OC)c3)C(=O)c3cc(OC)c(OC)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C28H29N3O8S/c1-33-18-8-9-19-24(14-18)40-28(30-19)31(27(32)17-12-22(36-4)26(39-7)23(13-17)37-5)29-15-16-10-20(34-2)25(38-6)21(11-16)35-3/h8-15H,1-7H3/b29-15+ |
| InChIKey | IAXCUSZVFKSOCW-WKULSOCRSA-N |
| XLogP | 5.04 |
| TPSA | 110.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|