C25H22BrN3O5S — CID 44942306
N-(6-bromo-1,3-benzothiazol-2-yl)-3,4,5-trimethoxy-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 44942306) has the molecular formula C25H22BrN3O5S and a molecular weight of 556.44 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-3,4,5-trimethoxy-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-3,4,5-trimethoxy-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942306 |
| Molecular Formula | C25H22BrN3O5S |
| Molecular Weight | 556.44 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-3,4,5-trimethoxy-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2cc(OC)c(OC)c(OC)c2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C25H22BrN3O5S/c1-31-18-8-5-15(6-9-18)14-27-29(25-28-19-10-7-17(26)13-22(19)35-25)24(30)16-11-20(32-2)23(34-4)21(12-16)33-3/h5-14H,1-4H3/b27-14+ |
| InChIKey | GQDYZDYJBNXZTE-MZJWZYIUSA-N |
| XLogP | 5.77 |
| TPSA | 82.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|