C23H15BrN4O2S — CID 44942313
N-(6-bromo-1,3-benzothiazol-2-yl)-4-cyano-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 44942313) has the molecular formula C23H15BrN4O2S and a molecular weight of 491.37 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-cyano-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-cyano-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942313 |
| Molecular Formula | C23H15BrN4O2S |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-cyano-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc(C#N)cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C23H15BrN4O2S/c1-30-19-9-4-16(5-10-19)14-26-28(22(29)17-6-2-15(13-25)3-7-17)23-27-20-11-8-18(24)12-21(20)31-23/h2-12,14H,1H3/b26-14+ |
| InChIKey | JXNRAIJMGASROW-VULFUBBASA-N |
| XLogP | 5.62 |
| TPSA | 78.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|