C29H22BrN3O2S — CID 44942351
4-benzyl-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 44942351) has the molecular formula C29H22BrN3O2S and a molecular weight of 556.49 g/mol. Its IUPAC name is 4-benzyl-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-benzyl-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942351 |
| Molecular Formula | C29H22BrN3O2S |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | 4-benzyl-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc(Cc3ccccc3)cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C29H22BrN3O2S/c1-35-25-14-9-22(10-15-25)19-31-33(29-32-26-16-13-24(30)18-27(26)36-29)28(34)23-11-7-21(8-12-23)17-20-5-3-2-4-6-20/h2-16,18-19H,17H2,1H3/b31-19+ |
| InChIKey | RDTWFXDBGCQPLV-ZCTHSVRISA-N |
| XLogP | 7.34 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|