C30H24Br2N4O3S2 — CID 44941588
4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide (PubChem CID 44941588) has the molecular formula C30H24Br2N4O3S2 and a molecular weight of 712.49 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44941588 |
| Molecular Formula | C30H24Br2N4O3S2 |
| Molecular Weight | 712.49 g/mol |
| Exact Mass | 709.97 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc(Br)cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C30H24Br2N4O3S2/c1-2-35(20-22-6-4-3-5-7-22)41(38,39)26-15-10-23(11-16-26)29(37)36(33-19-21-8-12-24(31)13-9-21)30-34-27-17-14-25(32)18-28(27)40-30/h3-19H,2,20H2,1H3/b33-19+ |
| InChIKey | FOEGZFLKROUNCC-HNSNBQBZSA-N |
| XLogP | 7.71 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.49 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|