C31H35BrN4O4S2 — CID 44941648
4-[bis(2-methylpropyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-ethoxyphenyl)methylideneamino]benzamide (PubChem CID 44941648) has the molecular formula C31H35BrN4O4S2 and a molecular weight of 671.68 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-ethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-ethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44941648 |
| Molecular Formula | C31H35BrN4O4S2 |
| Molecular Weight | 671.68 g/mol |
| Exact Mass | 670.13 |
| IUPAC Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-ethoxyphenyl)methylideneamino]benzamide |
| SMILES | CCOc1ccc(/C=N/N(C(=O)c2ccc(S(=O)(=O)N(CC(C)C)CC(C)C)cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C31H35BrN4O4S2/c1-6-40-26-12-7-23(8-13-26)18-33-36(31-34-28-16-11-25(32)17-29(28)41-31)30(37)24-9-14-27(15-10-24)42(38,39)35(19-21(2)3)20-22(4)5/h7-18,21-22H,6,19-20H2,1-5H3/b33-18+ |
| InChIKey | TZCOALJBVQTWQJ-DPNNOFEESA-N |
| XLogP | 7.44 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.68 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|