C30H28N6O4S2 — CID 44944119
4-[bis(2-cyanoethyl)sulfamoyl]-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 44944119) has the molecular formula C30H28N6O4S2 and a molecular weight of 600.73 g/mol. Its IUPAC name is 4-[bis(2-cyanoethyl)sulfamoyl]-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 44944119 |
| Molecular Formula | C30H28N6O4S2 |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1ccc(/C=N/N(C(=O)c2ccc(S(=O)(=O)N(CCC#N)CCC#N)cc2)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C30H28N6O4S2/c1-3-40-25-11-7-23(8-12-25)21-33-36(30-34-27-15-6-22(2)20-28(27)41-30)29(37)24-9-13-26(14-10-24)42(38,39)35(18-4-16-31)19-5-17-32/h6-15,20-21H,3-5,18-19H2,1-2H3/b33-21+ |
| InChIKey | XHFMQILKFYGACU-QNKGDIEWSA-N |
| XLogP | 5.50 |
| TPSA | 139.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|