C27H20Br2N6O3S2 — CID 44941540
4-[bis(2-cyanoethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide (PubChem CID 44941540) has the molecular formula C27H20Br2N6O3S2 and a molecular weight of 700.44 g/mol. Its IUPAC name is 4-[bis(2-cyanoethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide.
| Compound Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44941540 |
| Molecular Formula | C27H20Br2N6O3S2 |
| Molecular Weight | 700.44 g/mol |
| Exact Mass | 697.94 |
| IUPAC Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc(Br)cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C27H20Br2N6O3S2/c28-21-7-3-19(4-8-21)18-32-35(27-33-24-12-9-22(29)17-25(24)39-27)26(36)20-5-10-23(11-6-20)40(37,38)34(15-1-13-30)16-2-14-31/h3-12,17-18H,1-2,15-16H2/b32-18+ |
| InChIKey | SFLMPYUMLLBKJF-KCSSXMTESA-N |
| XLogP | 6.32 |
| TPSA | 130.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.44 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|