C28H25BrN4O4S2 — CID 44942345
4-[bis(prop-2-enyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 44942345) has the molecular formula C28H25BrN4O4S2 and a molecular weight of 625.57 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942345 |
| Molecular Formula | C28H25BrN4O4S2 |
| Molecular Weight | 625.57 g/mol |
| Exact Mass | 624.05 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc(OC)cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C28H25BrN4O4S2/c1-4-16-32(17-5-2)39(35,36)24-13-8-21(9-14-24)27(34)33(30-19-20-6-11-23(37-3)12-7-20)28-31-25-15-10-22(29)18-26(25)38-28/h4-15,18-19H,1-2,16-17H2,3H3/b30-19+ |
| InChIKey | YEXGOQYSNKAAFV-NDZAJKAJSA-N |
| XLogP | 6.11 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|