C29H30Br2N4O3S2 — CID 44941549
4-[bis(2-methylpropyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide (PubChem CID 44941549) has the molecular formula C29H30Br2N4O3S2 and a molecular weight of 706.53 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide.
| Compound Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44941549 |
| Molecular Formula | C29H30Br2N4O3S2 |
| Molecular Weight | 706.53 g/mol |
| Exact Mass | 704.01 |
| IUPAC Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(4-bromophenyl)methylideneamino]benzamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc(Br)cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C29H30Br2N4O3S2/c1-19(2)17-34(18-20(3)4)40(37,38)25-12-7-22(8-13-25)28(36)35(32-16-21-5-9-23(30)10-6-21)29-33-26-14-11-24(31)15-27(26)39-29/h5-16,19-20H,17-18H2,1-4H3/b32-16+ |
| InChIKey | QHRIZBXRHRPUAS-KPGMTVGESA-N |
| XLogP | 7.80 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|