C31H27N3O2S — CID 44944147
4-benzyl-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 44944147) has the molecular formula C31H27N3O2S and a molecular weight of 505.64 g/mol. Its IUPAC name is 4-benzyl-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-benzyl-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 44944147 |
| Molecular Formula | C31H27N3O2S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 4-benzyl-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1ccc(/C=N/N(C(=O)c2ccc(Cc3ccccc3)cc2)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C31H27N3O2S/c1-3-36-27-16-12-25(13-17-27)21-32-34(31-33-28-18-9-22(2)19-29(28)37-31)30(35)26-14-10-24(11-15-26)20-23-7-5-4-6-8-23/h4-19,21H,3,20H2,1-2H3/b32-21+ |
| InChIKey | CRZCWEICBZGLKL-RUMWWMSVSA-N |
| XLogP | 7.28 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|