C28H23N3O2S — CID 44944153
N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)naphthalene-1-carboxamide (PubChem CID 44944153) has the molecular formula C28H23N3O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)naphthalene-1-carboxamide.
| Compound Name | N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 44944153 |
| Molecular Formula | C28H23N3O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)naphthalene-1-carboxamide |
| SMILES | CCOc1ccc(/C=N/N(C(=O)c2cccc3ccccc23)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C28H23N3O2S/c1-3-33-22-14-12-20(13-15-22)18-29-31(28-30-25-16-11-19(2)17-26(25)34-28)27(32)24-10-6-8-21-7-4-5-9-23(21)24/h4-18H,3H2,1-2H3/b29-18+ |
| InChIKey | GFUFBHRINOKTNQ-RDRPBHBLSA-N |
| XLogP | 6.84 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|