C30H21N3O4S — CID 44944775
N-[(E)-(4-methoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 44944775) has the molecular formula C30H21N3O4S and a molecular weight of 519.58 g/mol. Its IUPAC name is N-[(E)-(4-methoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 44944775 |
| Molecular Formula | C30H21N3O4S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-N-(6-methyl-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2cc3c(ccc4ccccc43)oc2=O)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C30H21N3O4S/c1-18-7-13-25-27(15-18)38-30(32-25)33(31-17-19-8-11-21(36-2)12-9-19)28(34)24-16-23-22-6-4-3-5-20(22)10-14-26(23)37-29(24)35/h3-17H,1-2H3/b31-17+ |
| InChIKey | OZPVGNSKLCZNLO-KBVAKVRCSA-N |
| XLogP | 6.55 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|