C29H18FN3O4S — CID 44943568
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 44943568) has the molecular formula C29H18FN3O4S and a molecular weight of 523.55 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 44943568 |
| Molecular Formula | C29H18FN3O4S |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2cc3c(ccc4ccccc43)oc2=O)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C29H18FN3O4S/c1-36-20-10-6-17(7-11-20)16-31-33(29-32-24-12-9-19(30)14-26(24)38-29)27(34)23-15-22-21-5-3-2-4-18(21)8-13-25(22)37-28(23)35/h2-16H,1H3/b31-16+ |
| InChIKey | CTDLIHACAUMOGS-WCMJOSRZSA-N |
| XLogP | 6.38 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|