C28H16FN3O3S — CID 44942738
N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 44942738) has the molecular formula C28H16FN3O3S and a molecular weight of 493.52 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 44942738 |
| Molecular Formula | C28H16FN3O3S |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[(E)-benzylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | O=C(c1cc2c(ccc3ccccc32)oc1=O)N(/N=C/c1ccccc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C28H16FN3O3S/c29-19-11-12-23-25(14-19)36-28(31-23)32(30-16-17-6-2-1-3-7-17)26(33)22-15-21-20-9-5-4-8-18(20)10-13-24(21)35-27(22)34/h1-16H/b30-16+ |
| InChIKey | UDHSVDXDKDZUFR-OKCVXOCRSA-N |
| XLogP | 6.38 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|