C26H13BrN4O6S — CID 44942544
N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 44942544) has the molecular formula C26H13BrN4O6S and a molecular weight of 589.38 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 44942544 |
| Molecular Formula | C26H13BrN4O6S |
| Molecular Weight | 589.38 g/mol |
| Exact Mass | 587.97 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | O=C(c1cc2c(ccc3ccccc32)oc1=O)N(/N=C/c1ccc([N+](=O)[O-])o1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C26H13BrN4O6S/c27-15-6-8-20-22(11-15)38-26(29-20)30(28-13-16-7-10-23(36-16)31(34)35)24(32)19-12-18-17-4-2-1-3-14(17)5-9-21(18)37-25(19)33/h1-13H/b28-13+ |
| InChIKey | ZNRIAFCJCLZUCE-XODNFHPESA-N |
| XLogP | 6.50 |
| TPSA | 132.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|