C25H22BrN5O7S2 — CID 44942581
N-(6-bromo-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide (PubChem CID 44942581) has the molecular formula C25H22BrN5O7S2 and a molecular weight of 648.52 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942581 |
| Molecular Formula | C25H22BrN5O7S2 |
| Molecular Weight | 648.52 g/mol |
| Exact Mass | 647.01 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-[methyl(oxolan-2-ylmethyl)sulfamoyl]-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
| SMILES | CN(CC1CCCO1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])o2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C25H22BrN5O7S2/c1-29(15-19-3-2-12-37-19)40(35,36)20-8-4-16(5-9-20)24(32)30(27-14-18-7-11-23(38-18)31(33)34)25-28-21-10-6-17(26)13-22(21)39-25/h4-11,13-14,19H,2-3,12,15H2,1H3/b27-14+ |
| InChIKey | RANUIXIWWRPVAR-MZJWZYIUSA-N |
| XLogP | 5.04 |
| TPSA | 148.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|