C28H26BrN5O5S2 — CID 44942171
N-(6-bromo-1,3-benzothiazol-2-yl)-4-[cyclohexyl(methyl)sulfamoyl]-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide (PubChem CID 44942171) has the molecular formula C28H26BrN5O5S2 and a molecular weight of 656.58 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-4-[cyclohexyl(methyl)sulfamoyl]-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-[cyclohexyl(methyl)sulfamoyl]-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44942171 |
| Molecular Formula | C28H26BrN5O5S2 |
| Molecular Weight | 656.58 g/mol |
| Exact Mass | 655.06 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-4-[cyclohexyl(methyl)sulfamoyl]-N-[(E)-(4-nitrophenyl)methylideneamino]benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])cc2)c2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C28H26BrN5O5S2/c1-32(22-5-3-2-4-6-22)41(38,39)24-14-9-20(10-15-24)27(35)33(28-31-25-16-11-21(29)17-26(25)40-28)30-18-19-7-12-23(13-8-19)34(36)37/h7-18,22H,2-6H2,1H3/b30-18+ |
| InChIKey | ULEFMVVSPRGMSL-UXHLAJHPSA-N |
| XLogP | 6.60 |
| TPSA | 126.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|