C28H26F2N4O3S2 — CID 44943496
4-[cyclohexyl(methyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]benzamide (PubChem CID 44943496) has the molecular formula C28H26F2N4O3S2 and a molecular weight of 568.67 g/mol. Its IUPAC name is 4-[cyclohexyl(methyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]benzamide.
| Compound Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943496 |
| Molecular Formula | C28H26F2N4O3S2 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 4-[cyclohexyl(methyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-fluorophenyl)methylideneamino]benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2ccc(F)cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C28H26F2N4O3S2/c1-33(23-5-3-2-4-6-23)39(36,37)24-14-9-20(10-15-24)27(35)34(31-18-19-7-11-21(29)12-8-19)28-32-25-16-13-22(30)17-26(25)38-28/h7-18,23H,2-6H2,1H3/b31-18+ |
| InChIKey | MFKZUURIHBYEHX-FDAWAROLSA-N |
| XLogP | 6.21 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|