C28H27FN4O3S2 — CID 44943288
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-4-(3-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 44943288) has the molecular formula C28H27FN4O3S2 and a molecular weight of 550.68 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-4-(3-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-4-(3-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 44943288 |
| Molecular Formula | C28H27FN4O3S2 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-4-(3-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | Cc1ccc(/C=N/N(C(=O)c2ccc(S(=O)(=O)N3CCCC(C)C3)cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C28H27FN4O3S2/c1-19-5-7-21(8-6-19)17-30-33(28-31-25-14-11-23(29)16-26(25)37-28)27(34)22-9-12-24(13-10-22)38(35,36)32-15-3-4-20(2)18-32/h5-14,16-17,20H,3-4,15,18H2,1-2H3/b30-17+ |
| InChIKey | RNTTWZOQBCJEIZ-OCSSWDANSA-N |
| XLogP | 5.85 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|