C30H32N4O5S2 — CID 44945982
4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 44945982) has the molecular formula C30H32N4O5S2 and a molecular weight of 592.74 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945982 |
| Molecular Formula | C30H32N4O5S2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc(S(=O)(=O)N3CC(C)CC(C)C3)cc2)c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C30H32N4O5S2/c1-20-15-21(2)19-33(18-20)41(36,37)26-12-7-23(8-13-26)29(35)34(31-17-22-5-9-24(38-3)10-6-22)30-32-27-14-11-25(39-4)16-28(27)40-30/h5-14,16-17,20-21H,15,18-19H2,1-4H3/b31-17+ |
| InChIKey | XHTLOZFXBKOBRV-KBVAKVRCSA-N |
| XLogP | 5.66 |
| TPSA | 101.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|