C28H27FN4O4S2 — CID 44943547
4-(azepan-1-ylsulfonyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 44943547) has the molecular formula C28H27FN4O4S2 and a molecular weight of 566.68 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943547 |
| Molecular Formula | C28H27FN4O4S2 |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C28H27FN4O4S2/c1-37-23-11-6-20(7-12-23)19-30-33(28-31-25-15-10-22(29)18-26(25)38-28)27(34)21-8-13-24(14-9-21)39(35,36)32-16-4-2-3-5-17-32/h6-15,18-19H,2-5,16-17H2,1H3/b30-19+ |
| InChIKey | NAPLWPFKIGLGSJ-NDZAJKAJSA-N |
| XLogP | 5.69 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|