C26H24FN5O5S3 — CID 44943655
4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44943655) has the molecular formula C26H24FN5O5S3 and a molecular weight of 601.71 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943655 |
| Molecular Formula | C26H24FN5O5S3 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.09 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(C(=O)N(/N=C/c3ccc([N+](=O)[O-])s3)c3nc4ccc(F)cc4s3)cc2)C1 |
| InChI | InChI=1S/C26H24FN5O5S3/c1-16-11-17(2)15-30(14-16)40(36,37)21-7-3-18(4-8-21)25(33)31(28-13-20-6-10-24(38-20)32(34)35)26-29-22-9-5-19(27)12-23(22)39-26/h3-10,12-13,16-17H,11,14-15H2,1-2H3/b28-13+ |
| InChIKey | HPRZJCOGFXRGLF-XODNFHPESA-N |
| XLogP | 5.75 |
| TPSA | 126.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|