C20H13BrN4O3S2 — CID 44944825
4-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44944825) has the molecular formula C20H13BrN4O3S2 and a molecular weight of 501.39 g/mol. Its IUPAC name is 4-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44944825 |
| Molecular Formula | C20H13BrN4O3S2 |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 499.96 |
| IUPAC Name | 4-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])s3)C(=O)c3ccc(Br)cc3)sc2c1 |
| InChI | InChI=1S/C20H13BrN4O3S2/c1-12-2-8-16-17(10-12)30-20(23-16)24(19(26)13-3-5-14(21)6-4-13)22-11-15-7-9-18(29-15)25(27)28/h2-11H,1H3/b22-11+ |
| InChIKey | HKWDNCPVAAFJAH-SSDVNMTOSA-N |
| XLogP | 6.02 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|