C25H15FN4O3S2 — CID 44943615
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-phenylbenzamide (PubChem CID 44943615) has the molecular formula C25H15FN4O3S2 and a molecular weight of 502.55 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-phenylbenzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 44943615 |
| Molecular Formula | C25H15FN4O3S2 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-4-phenylbenzamide |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N(/N=C/c1ccc([N+](=O)[O-])s1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C25H15FN4O3S2/c26-19-10-12-21-22(14-19)35-25(28-21)29(27-15-20-11-13-23(34-20)30(32)33)24(31)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-15H/b27-15+ |
| InChIKey | TXKNZWJTMUYOAS-JFLMPSFJSA-N |
| XLogP | 6.75 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|