C22H18N4O5S2 — CID 44944907
2,3-dimethoxy-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide (PubChem CID 44944907) has the molecular formula C22H18N4O5S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2,3-dimethoxy-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 2,3-dimethoxy-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44944907 |
| Molecular Formula | C22H18N4O5S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 2,3-dimethoxy-N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrothiophen-2-yl)methylideneamino]benzamide |
| SMILES | COc1cccc(C(=O)N(/N=C/c2ccc([N+](=O)[O-])s2)c2nc3ccc(C)cc3s2)c1OC |
| InChI | InChI=1S/C22H18N4O5S2/c1-13-7-9-16-18(11-13)33-22(24-16)25(23-12-14-8-10-19(32-14)26(28)29)21(27)15-5-4-6-17(30-2)20(15)31-3/h4-12H,1-3H3/b23-12+ |
| InChIKey | LAWWIAJKFIJTEC-FSJBWODESA-N |
| XLogP | 5.27 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|