C21H16N4O3S2 — CID 44944458
N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-5-nitrothiophene-2-carboxamide (PubChem CID 44944458) has the molecular formula C21H16N4O3S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 44944458 |
| Molecular Formula | C21H16N4O3S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-N-[(E)-(4-methylphenyl)methylideneamino]-5-nitrothiophene-2-carboxamide |
| SMILES | Cc1ccc(/C=N/N(C(=O)c2ccc([N+](=O)[O-])s2)c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C21H16N4O3S2/c1-13-3-6-15(7-4-13)12-22-24(20(26)17-9-10-19(29-17)25(27)28)21-23-16-8-5-14(2)11-18(16)30-21/h3-12H,1-2H3/b22-12+ |
| InChIKey | DJYGGYDHOHBRIZ-WSDLNYQXSA-N |
| XLogP | 5.56 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|